C25H34IN5 — CID 109389315
1-(2,3-diphenylpropyl)-2-methyl-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 109389315) has the molecular formula C25H34IN5 and a molecular weight of 531.49 g/mol. Its IUPAC name is 1-(2,3-diphenylpropyl)-2-methyl-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(2,3-diphenylpropyl)-2-methyl-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109389315 |
| Molecular Formula | C25H34IN5 |
| Molecular Weight | 531.49 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | 1-(2,3-diphenylpropyl)-2-methyl-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1c(C)nn(C)c1C)NCC(Cc1ccccc1)c1ccccc1.I |
| InChI | InChI=1S/C25H33N5.HI/c1-19-24(20(2)30(4)29-19)15-16-27-25(26-3)28-18-23(22-13-9-6-10-14-22)17-21-11-7-5-8-12-21;/h5-14,23H,15-18H2,1-4H3,(H2,26,27,28);1H |
| InChIKey | SZQACCKDWLFFDA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|