C26H30N6 — CID 109389810
1-(2,3-diphenylpropyl)-2-methyl-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine (PubChem CID 109389810) has the molecular formula C26H30N6 and a molecular weight of 426.57 g/mol. Its IUPAC name is 1-(2,3-diphenylpropyl)-2-methyl-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine.
| Compound Name | 1-(2,3-diphenylpropyl)-2-methyl-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine |
|---|---|
| PubChem CID | 109389810 |
| Molecular Formula | C26H30N6 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | 1-(2,3-diphenylpropyl)-2-methyl-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine |
| SMILES | C/N=C(/NCCCc1nnc2ccccn12)NCC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H30N6/c1-27-26(28-17-10-16-25-31-30-24-15-8-9-18-32(24)25)29-20-23(22-13-6-3-7-14-22)19-21-11-4-2-5-12-21/h2-9,11-15,18,23H,10,16-17,19-20H2,1H3,(H2,27,28,29) |
| InChIKey | RLSWHZRILCGNFQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|