C20H27N5O — CID 111603265
2-methyl-1-[(3-methyl-1-benzofuran-2-yl)methyl]-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine (PubChem CID 111603265) has the molecular formula C20H27N5O and a molecular weight of 353.47 g/mol. Its IUPAC name is 2-methyl-1-[(3-methyl-1-benzofuran-2-yl)methyl]-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine.
| Compound Name | 2-methyl-1-[(3-methyl-1-benzofuran-2-yl)methyl]-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111603265 |
| Molecular Formula | C20H27N5O |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | 2-methyl-1-[(3-methyl-1-benzofuran-2-yl)methyl]-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine |
| SMILES | C/N=C(\NCCc1c(C)nn(C)c1C)NCc1oc2ccccc2c1C |
| InChI | InChI=1S/C20H27N5O/c1-13-16-8-6-7-9-18(16)26-19(13)12-23-20(21-4)22-11-10-17-14(2)24-25(5)15(17)3/h6-9H,10-12H2,1-5H3,(H2,21,22,23) |
| InChIKey | OEQSLCMTYNKEPE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 67.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|