C24H27N5O — CID 111602523
1-[2-(1-benzylimidazol-2-yl)ethyl]-2-methyl-3-[(3-methyl-1-benzofuran-2-yl)methyl]guanidine (PubChem CID 111602523) has the molecular formula C24H27N5O and a molecular weight of 401.51 g/mol. Its IUPAC name is 1-[2-(1-benzylimidazol-2-yl)ethyl]-2-methyl-3-[(3-methyl-1-benzofuran-2-yl)methyl]guanidine.
| Compound Name | 1-[2-(1-benzylimidazol-2-yl)ethyl]-2-methyl-3-[(3-methyl-1-benzofuran-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111602523 |
| Molecular Formula | C24H27N5O |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 1-[2-(1-benzylimidazol-2-yl)ethyl]-2-methyl-3-[(3-methyl-1-benzofuran-2-yl)methyl]guanidine |
| SMILES | C/N=C(\NCCc1nccn1Cc1ccccc1)NCc1oc2ccccc2c1C |
| InChI | InChI=1S/C24H27N5O/c1-18-20-10-6-7-11-21(20)30-22(18)16-28-24(25-2)27-13-12-23-26-14-15-29(23)17-19-8-4-3-5-9-19/h3-11,14-15H,12-13,16-17H2,1-2H3,(H2,25,27,28) |
| InChIKey | LWQABDFZMZXDSX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 67.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|