C24H29IN4O2 — CID 109389519
N-[2-[[N-(2,3-diphenylpropyl)-N'-methylcarbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide (PubChem CID 109389519) has the molecular formula C24H29IN4O2 and a molecular weight of 532.43 g/mol. Its IUPAC name is N-[2-[[N-(2,3-diphenylpropyl)-N'-methylcarbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[2-[[N-(2,3-diphenylpropyl)-N'-methylcarbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 109389519 |
| Molecular Formula | C24H29IN4O2 |
| Molecular Weight | 532.43 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | N-[2-[[N-(2,3-diphenylpropyl)-N'-methylcarbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)c1ccco1)NCC(Cc1ccccc1)c1ccccc1.I |
| InChI | InChI=1S/C24H28N4O2.HI/c1-25-24(27-15-14-26-23(29)22-13-8-16-30-22)28-18-21(20-11-6-3-7-12-20)17-19-9-4-2-5-10-19;/h2-13,16,21H,14-15,17-18H2,1H3,(H,26,29)(H2,25,27,28);1H |
| InChIKey | XCWNIPYDDVATDN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|