C23H26N4O2 — CID 111356954
N-[2-[[N-(2,2-diphenylethyl)-N'-methylcarbamimidoyl]amino]ethyl]furan-2-carboxamide (PubChem CID 111356954) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is N-[2-[[N-(2,2-diphenylethyl)-N'-methylcarbamimidoyl]amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[N-(2,2-diphenylethyl)-N'-methylcarbamimidoyl]amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 111356954 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | N-[2-[[N-(2,2-diphenylethyl)-N'-methylcarbamimidoyl]amino]ethyl]furan-2-carboxamide |
| SMILES | C/N=C(\NCCNC(=O)c1ccco1)NCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H26N4O2/c1-24-23(26-15-14-25-22(28)21-13-8-16-29-21)27-17-20(18-9-4-2-5-10-18)19-11-6-3-7-12-19/h2-13,16,20H,14-15,17H2,1H3,(H,25,28)(H2,24,26,27) |
| InChIKey | RIQBVMJHSVMELQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|