C26H40IN5 — CID 109389699
1-(2,3-diphenylpropyl)-2-methyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide (PubChem CID 109389699) has the molecular formula C26H40IN5 and a molecular weight of 549.55 g/mol. Its IUPAC name is 1-(2,3-diphenylpropyl)-2-methyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-(2,3-diphenylpropyl)-2-methyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109389699 |
| Molecular Formula | C26H40IN5 |
| Molecular Weight | 549.55 g/mol |
| Exact Mass | 549.23 |
| IUPAC Name | 1-(2,3-diphenylpropyl)-2-methyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCN1CCCN(C)CC1)NCC(Cc1ccccc1)c1ccccc1.I |
| InChI | InChI=1S/C26H39N5.HI/c1-27-26(28-15-9-17-31-18-10-16-30(2)19-20-31)29-22-25(24-13-7-4-8-14-24)21-23-11-5-3-6-12-23;/h3-8,11-14,25H,9-10,15-22H2,1-2H3,(H2,27,28,29);1H |
| InChIKey | TYVKMMJLIDFHHC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|