C27H41N5 — CID 109389332
1-(2,3-diphenylpropyl)-3-[4-(4-ethylpiperazin-1-yl)butyl]-2-methylguanidine (PubChem CID 109389332) has the molecular formula C27H41N5 and a molecular weight of 435.66 g/mol. Its IUPAC name is 1-(2,3-diphenylpropyl)-3-[4-(4-ethylpiperazin-1-yl)butyl]-2-methylguanidine.
| Compound Name | 1-(2,3-diphenylpropyl)-3-[4-(4-ethylpiperazin-1-yl)butyl]-2-methylguanidine |
|---|---|
| PubChem CID | 109389332 |
| Molecular Formula | C27H41N5 |
| Molecular Weight | 435.66 g/mol |
| Exact Mass | 435.34 |
| IUPAC Name | 1-(2,3-diphenylpropyl)-3-[4-(4-ethylpiperazin-1-yl)butyl]-2-methylguanidine |
| SMILES | CCN1CCN(CCCCN/C(=N/C)NCC(Cc2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H41N5/c1-3-31-18-20-32(21-19-31)17-11-10-16-29-27(28-2)30-23-26(25-14-8-5-9-15-25)22-24-12-6-4-7-13-24/h4-9,12-15,26H,3,10-11,16-23H2,1-2H3,(H2,28,29,30) |
| InChIKey | MAPQCPCBQYDFDE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.66 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|