C13H24N4O3 — CID 119639591
N-(2-amino-2-ethylbutyl)-4-(2,5-dioxoimidazolidin-1-yl)butanamide (PubChem CID 119639591) has the molecular formula C13H24N4O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-4-(2,5-dioxoimidazolidin-1-yl)butanamide.
| Compound Name | N-(2-amino-2-ethylbutyl)-4-(2,5-dioxoimidazolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 119639591 |
| Molecular Formula | C13H24N4O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-4-(2,5-dioxoimidazolidin-1-yl)butanamide |
| SMILES | CCC(N)(CC)CNC(=O)CCCN1C(=O)CNC1=O |
| InChI | InChI=1S/C13H24N4O3/c1-3-13(14,4-2)9-16-10(18)6-5-7-17-11(19)8-15-12(17)20/h3-9,14H2,1-2H3,(H,15,20)(H,16,18) |
| InChIKey | HSDJZVQTGMTLFK-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|