C21H27N3O3S — CID 92722789
4-[[(8aS)-5,8-dioxo-1,3,6,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazin-7-yl]methyl]-N-cycloheptylbenzamide (PubChem CID 92722789) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is 4-[[(8aS)-5,8-dioxo-1,3,6,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazin-7-yl]methyl]-N-cycloheptylbenzamide.
| Compound Name | 4-[[(8aS)-5,8-dioxo-1,3,6,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazin-7-yl]methyl]-N-cycloheptylbenzamide |
|---|---|
| PubChem CID | 92722789 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 4-[[(8aS)-5,8-dioxo-1,3,6,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazin-7-yl]methyl]-N-cycloheptylbenzamide |
| SMILES | O=C(NC1CCCCCC1)c1ccc(CN2CC(=O)N3CSC[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C21H27N3O3S/c25-19-12-23(21(27)18-13-28-14-24(18)19)11-15-7-9-16(10-8-15)20(26)22-17-5-3-1-2-4-6-17/h7-10,17-18H,1-6,11-14H2,(H,22,26)/t18-/m1/s1 |
| InChIKey | SWIBXPSQEIZGEU-GOSISDBHSA-N |
| XLogP | 2.38 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |