C22H22ClN3O3 — CID 46275416
N-(4-chlorophenyl)-4-[(1,4-dioxo-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazin-2-yl)methyl]benzamide (PubChem CID 46275416) has the molecular formula C22H22ClN3O3 and a molecular weight of 411.89 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[(1,4-dioxo-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazin-2-yl)methyl]benzamide.
| Compound Name | N-(4-chlorophenyl)-4-[(1,4-dioxo-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 46275416 |
| Molecular Formula | C22H22ClN3O3 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | N-(4-chlorophenyl)-4-[(1,4-dioxo-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazin-2-yl)methyl]benzamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1ccc(CN2CC(=O)N3CCCCC3C2=O)cc1 |
| InChI | InChI=1S/C22H22ClN3O3/c23-17-8-10-18(11-9-17)24-21(28)16-6-4-15(5-7-16)13-25-14-20(27)26-12-2-1-3-19(26)22(25)29/h4-11,19H,1-3,12-14H2,(H,24,28) |
| InChIKey | UIZUYNQFDWBQSH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |