C22H23N3O3 — CID 92721622
4-[[(8aS)-1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]-N-(2-methylphenyl)benzamide (PubChem CID 92721622) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 4-[[(8aS)-1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]-N-(2-methylphenyl)benzamide.
| Compound Name | 4-[[(8aS)-1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]-N-(2-methylphenyl)benzamide |
|---|---|
| PubChem CID | 92721622 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 4-[[(8aS)-1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]-N-(2-methylphenyl)benzamide |
| SMILES | Cc1ccccc1NC(=O)c1ccc(CN2CC(=O)N3CCC[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C22H23N3O3/c1-15-5-2-3-6-18(15)23-21(27)17-10-8-16(9-11-17)13-24-14-20(26)25-12-4-7-19(25)22(24)28/h2-3,5-6,8-11,19H,4,7,12-14H2,1H3,(H,23,27)/t19-/m0/s1 |
| InChIKey | BCAWIAGZDHZSIJ-IBGZPJMESA-N |
| XLogP | 2.58 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |