C26H28N4O3 — CID 145031062
N-[2-amino-5-[(2E)-penta-2,4-dien-2-yl]phenyl]-4-[(1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]benzamide (PubChem CID 145031062) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is N-[2-amino-5-[(2E)-penta-2,4-dien-2-yl]phenyl]-4-[(1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]benzamide.
| Compound Name | N-[2-amino-5-[(2E)-penta-2,4-dien-2-yl]phenyl]-4-[(1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 145031062 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | N-[2-amino-5-[(2E)-penta-2,4-dien-2-yl]phenyl]-4-[(1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]benzamide |
| SMILES | C=C/C=C(\C)c1ccc(N)c(NC(=O)c2ccc(CN3CC(=O)N4CCCC4C3=O)cc2)c1 |
| InChI | InChI=1S/C26H28N4O3/c1-3-5-17(2)20-11-12-21(27)22(14-20)28-25(32)19-9-7-18(8-10-19)15-29-16-24(31)30-13-4-6-23(30)26(29)33/h3,5,7-12,14,23H,1,4,6,13,15-16,27H2,2H3,(H,28,32)/b17-5+ |
| InChIKey | OGZQQOQRWCKQRX-YAXRCOADSA-N |
| XLogP | 3.44 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|