C23H24BrN3O3 — CID 92705567
4-[[(9aS)-1,4-dioxo-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazin-2-yl]methyl]-N-[(3-bromophenyl)methyl]benzamide (PubChem CID 92705567) has the molecular formula C23H24BrN3O3 and a molecular weight of 470.37 g/mol. Its IUPAC name is 4-[[(9aS)-1,4-dioxo-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazin-2-yl]methyl]-N-[(3-bromophenyl)methyl]benzamide.
| Compound Name | 4-[[(9aS)-1,4-dioxo-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazin-2-yl]methyl]-N-[(3-bromophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 92705567 |
| Molecular Formula | C23H24BrN3O3 |
| Molecular Weight | 470.37 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | 4-[[(9aS)-1,4-dioxo-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazin-2-yl]methyl]-N-[(3-bromophenyl)methyl]benzamide |
| SMILES | O=C(NCc1cccc(Br)c1)c1ccc(CN2CC(=O)N3CCCC[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C23H24BrN3O3/c24-19-5-3-4-17(12-19)13-25-22(29)18-9-7-16(8-10-18)14-26-15-21(28)27-11-2-1-6-20(27)23(26)30/h3-5,7-10,12,20H,1-2,6,11,13-15H2,(H,25,29)/t20-/m0/s1 |
| InChIKey | SMZFBMWYMBCNEZ-FQEVSTJZSA-N |
| XLogP | 3.10 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |