C26H31N3O4 — CID 20907983
4-[(1,4-dioxo-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazin-2-yl)methyl]-N-[(4-propoxyphenyl)methyl]benzamide (PubChem CID 20907983) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is 4-[(1,4-dioxo-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazin-2-yl)methyl]-N-[(4-propoxyphenyl)methyl]benzamide.
| Compound Name | 4-[(1,4-dioxo-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazin-2-yl)methyl]-N-[(4-propoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 20907983 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | 4-[(1,4-dioxo-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazin-2-yl)methyl]-N-[(4-propoxyphenyl)methyl]benzamide |
| SMILES | CCCOc1ccc(CNC(=O)c2ccc(CN3CC(=O)N4CCCCC4C3=O)cc2)cc1 |
| InChI | InChI=1S/C26H31N3O4/c1-2-15-33-22-12-8-19(9-13-22)16-27-25(31)21-10-6-20(7-11-21)17-28-18-24(30)29-14-4-3-5-23(29)26(28)32/h6-13,23H,2-5,14-18H2,1H3,(H,27,31) |
| InChIKey | HWELOGAXQVZOBN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |