C27H33N3O5 — CID 92703980
4-[[(8aR)-1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]-N-[2-(3,4-diethoxyphenyl)ethyl]benzamide (PubChem CID 92703980) has the molecular formula C27H33N3O5 and a molecular weight of 479.58 g/mol. Its IUPAC name is 4-[[(8aR)-1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]-N-[2-(3,4-diethoxyphenyl)ethyl]benzamide.
| Compound Name | 4-[[(8aR)-1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]-N-[2-(3,4-diethoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 92703980 |
| Molecular Formula | C27H33N3O5 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | 4-[[(8aR)-1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]-N-[2-(3,4-diethoxyphenyl)ethyl]benzamide |
| SMILES | CCOc1ccc(CCNC(=O)c2ccc(CN3CC(=O)N4CCC[C@@H]4C3=O)cc2)cc1OCC |
| InChI | InChI=1S/C27H33N3O5/c1-3-34-23-12-9-19(16-24(23)35-4-2)13-14-28-26(32)21-10-7-20(8-11-21)17-29-18-25(31)30-15-5-6-22(30)27(29)33/h7-12,16,22H,3-6,13-15,17-18H2,1-2H3,(H,28,32)/t22-/m1/s1 |
| InChIKey | XDLJVHYOOOFXFG-JOCHJYFZSA-N |
| XLogP | 2.79 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |