C23H24BrN3O4 — CID 46272432
N-[(5-bromo-2-methoxyphenyl)methyl]-4-[(1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]benzamide (PubChem CID 46272432) has the molecular formula C23H24BrN3O4 and a molecular weight of 486.37 g/mol. Its IUPAC name is N-[(5-bromo-2-methoxyphenyl)methyl]-4-[(1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]benzamide.
| Compound Name | N-[(5-bromo-2-methoxyphenyl)methyl]-4-[(1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 46272432 |
| Molecular Formula | C23H24BrN3O4 |
| Molecular Weight | 486.37 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | N-[(5-bromo-2-methoxyphenyl)methyl]-4-[(1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]benzamide |
| SMILES | COc1ccc(Br)cc1CNC(=O)c1ccc(CN2CC(=O)N3CCCC3C2=O)cc1 |
| InChI | InChI=1S/C23H24BrN3O4/c1-31-20-9-8-18(24)11-17(20)12-25-22(29)16-6-4-15(5-7-16)13-26-14-21(28)27-10-2-3-19(27)23(26)30/h4-9,11,19H,2-3,10,12-14H2,1H3,(H,25,29) |
| InChIKey | SATZSGVAHBCVIN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |