C22H23N3O3S — CID 46277163
4-[(5,8-dioxo-1,3,6,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazin-7-yl)methyl]-N-(1-phenylethyl)benzamide (PubChem CID 46277163) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is 4-[(5,8-dioxo-1,3,6,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazin-7-yl)methyl]-N-(1-phenylethyl)benzamide.
| Compound Name | 4-[(5,8-dioxo-1,3,6,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazin-7-yl)methyl]-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 46277163 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 4-[(5,8-dioxo-1,3,6,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazin-7-yl)methyl]-N-(1-phenylethyl)benzamide |
| SMILES | CC(NC(=O)c1ccc(CN2CC(=O)N3CSCC3C2=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H23N3O3S/c1-15(17-5-3-2-4-6-17)23-21(27)18-9-7-16(8-10-18)11-24-12-20(26)25-14-29-13-19(25)22(24)28/h2-10,15,19H,11-14H2,1H3,(H,23,27) |
| InChIKey | GNEQYZPWIXOFNW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |