C24H34N4O3S — CID 124769892
4-[[(8aR)-5,8-dioxo-1,3,6,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazin-7-yl]methyl]-N-[3-[(2R,6S)-2,6-dimethylpiperidin-1-yl]propyl]benzamide (PubChem CID 124769892) has the molecular formula C24H34N4O3S and a molecular weight of 458.63 g/mol. Its IUPAC name is 4-[[(8aR)-5,8-dioxo-1,3,6,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazin-7-yl]methyl]-N-[3-[(2R,6S)-2,6-dimethylpiperidin-1-yl]propyl]benzamide.
| Compound Name | 4-[[(8aR)-5,8-dioxo-1,3,6,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazin-7-yl]methyl]-N-[3-[(2R,6S)-2,6-dimethylpiperidin-1-yl]propyl]benzamide |
|---|---|
| PubChem CID | 124769892 |
| Molecular Formula | C24H34N4O3S |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | 4-[[(8aR)-5,8-dioxo-1,3,6,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazin-7-yl]methyl]-N-[3-[(2R,6S)-2,6-dimethylpiperidin-1-yl]propyl]benzamide |
| SMILES | C[C@@H]1CCC[C@H](C)N1CCCNC(=O)c1ccc(CN2CC(=O)N3CSC[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C24H34N4O3S/c1-17-5-3-6-18(2)27(17)12-4-11-25-23(30)20-9-7-19(8-10-20)13-26-14-22(29)28-16-32-15-21(28)24(26)31/h7-10,17-18,21H,3-6,11-16H2,1-2H3,(H,25,30)/t17-,18+,21-/m0/s1 |
| InChIKey | LKINDXDWCQDAOQ-UEXGIBASSA-N |
| XLogP | 2.31 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|