C17H21N3O3 — CID 32747160
3-[[4-[(2S)-2-methylpiperidine-1-carbonyl]phenyl]methyl]imidazolidine-2,4-dione (PubChem CID 32747160) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is 3-[[4-[(2S)-2-methylpiperidine-1-carbonyl]phenyl]methyl]imidazolidine-2,4-dione.
| Compound Name | 3-[[4-[(2S)-2-methylpiperidine-1-carbonyl]phenyl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 32747160 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 3-[[4-[(2S)-2-methylpiperidine-1-carbonyl]phenyl]methyl]imidazolidine-2,4-dione |
| SMILES | C[C@H]1CCCCN1C(=O)c1ccc(CN2C(=O)CNC2=O)cc1 |
| InChI | InChI=1S/C17H21N3O3/c1-12-4-2-3-9-19(12)16(22)14-7-5-13(6-8-14)11-20-15(21)10-18-17(20)23/h5-8,12H,2-4,9-11H2,1H3,(H,18,23)/t12-/m0/s1 |
| InChIKey | LGCWJKKAVNPFBZ-LBPRGKRZSA-N |
| XLogP | 1.75 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|