C20H21NO2 — CID 2532732
[4-[(2S)-2-methylpiperidine-1-carbonyl]phenyl]-phenylmethanone (PubChem CID 2532732) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is [4-[(2S)-2-methylpiperidine-1-carbonyl]phenyl]-phenylmethanone.
| Compound Name | [4-[(2S)-2-methylpiperidine-1-carbonyl]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 2532732 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | [4-[(2S)-2-methylpiperidine-1-carbonyl]phenyl]-phenylmethanone |
| SMILES | C[C@H]1CCCCN1C(=O)c1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H21NO2/c1-15-7-5-6-14-21(15)20(23)18-12-10-17(11-13-18)19(22)16-8-3-2-4-9-16/h2-4,8-13,15H,5-7,14H2,1H3/t15-/m0/s1 |
| InChIKey | RLKJQEZLORTTJE-HNNXBMFYSA-N |
| XLogP | 3.93 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |