C21H21NO — CID 24640330
(2-methylpiperidin-1-yl)-[4-(2-phenylethynyl)phenyl]methanone (PubChem CID 24640330) has the molecular formula C21H21NO and a molecular weight of 303.41 g/mol. Its IUPAC name is (2-methylpiperidin-1-yl)-[4-(2-phenylethynyl)phenyl]methanone.
| Compound Name | (2-methylpiperidin-1-yl)-[4-(2-phenylethynyl)phenyl]methanone |
|---|---|
| PubChem CID | 24640330 |
| Molecular Formula | C21H21NO |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | (2-methylpiperidin-1-yl)-[4-(2-phenylethynyl)phenyl]methanone |
| SMILES | CC1CCCCN1C(=O)c1ccc(C#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H21NO/c1-17-7-5-6-16-22(17)21(23)20-14-12-19(13-15-20)11-10-18-8-3-2-4-9-18/h2-4,8-9,12-15,17H,5-7,16H2,1H3 |
| InChIKey | UIMFKCOHHRGUBN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|