C17H16BrNO2 — CID 71447397
7-bromo-1-[(4-methylphenyl)methyl]-5H-4,1-benzoxazepin-2-one (PubChem CID 71447397) has the molecular formula C17H16BrNO2 and a molecular weight of 346.22 g/mol. Its IUPAC name is 7-bromo-1-[(4-methylphenyl)methyl]-5H-4,1-benzoxazepin-2-one.
| Compound Name | 7-bromo-1-[(4-methylphenyl)methyl]-5H-4,1-benzoxazepin-2-one |
|---|---|
| PubChem CID | 71447397 |
| Molecular Formula | C17H16BrNO2 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 7-bromo-1-[(4-methylphenyl)methyl]-5H-4,1-benzoxazepin-2-one |
| SMILES | Cc1ccc(CN2C(=O)COCc3cc(Br)ccc32)cc1 |
| InChI | InChI=1S/C17H16BrNO2/c1-12-2-4-13(5-3-12)9-19-16-7-6-15(18)8-14(16)10-21-11-17(19)20/h2-8H,9-11H2,1H3 |
| InChIKey | GZQGWBGQDPGDHN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |