About 4-benzyl-6-bromo-1,4-benzoxazin-3-one
4-benzyl-6-bromo-1,4-benzoxazin-3-one (PubChem CID 68733662) has the molecular formula C15H12BrNO2
and a molecular weight of 318.17 g/mol. Its IUPAC name is 4-benzyl-6-bromo-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 4-benzyl-6-bromo-1,4-benzoxazin-3-one |
| PubChem CID | 68733662 |
| Molecular Formula | C15H12BrNO2 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | 4-benzyl-6-bromo-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(Br)cc2N1Cc1ccccc1 |
| InChI | InChI=1S/C15H12BrNO2/c16-12-6-7-14-13(8-12)17(15(18)10-19-14)9-11-4-2-1-3-5-11/h1-8H,9-10H2 |
| InChIKey | XVMDQDODKWPXEB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-benzyl-6-bromo-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-6-bromo-1,4-benzoxazin-3-one?
The IUPAC name of 4-benzyl-6-bromo-1,4-benzoxazin-3-one (CID 68733662) is 4-benzyl-6-bromo-1,4-benzoxazin-3-one.
What is the SMILES notation for 4-benzyl-6-bromo-1,4-benzoxazin-3-one?
The canonical SMILES for 4-benzyl-6-bromo-1,4-benzoxazin-3-one is O=C1COc2ccc(Br)cc2N1Cc1ccccc1.
What is the InChIKey of 4-benzyl-6-bromo-1,4-benzoxazin-3-one?
The InChIKey is XVMDQDODKWPXEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12BrNO2/c16-12-6-7-14-13(8-12)17(15(18)10-19-14)9-11-4-2-1-3-5-11/h1-8H,9-10H2.
What are the key properties of 4-benzyl-6-bromo-1,4-benzoxazin-3-one?
4-benzyl-6-bromo-1,4-benzoxazin-3-one has a molecular weight of 318.17 g/mol, XLogP of 3.37, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-6-bromo-1,4-benzoxazin-3-one is sourced from PubChem (CID 68733662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).