C15H12BrNO2 — CID 68733662
4-benzyl-6-bromo-1,4-benzoxazin-3-one (PubChem CID 68733662) has the molecular formula C15H12BrNO2 and a molecular weight of 318.17 g/mol. Its IUPAC name is 4-benzyl-6-bromo-1,4-benzoxazin-3-one.
| Compound Name | 4-benzyl-6-bromo-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 68733662 |
| Molecular Formula | C15H12BrNO2 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | 4-benzyl-6-bromo-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(Br)cc2N1Cc1ccccc1 |
| InChI | InChI=1S/C15H12BrNO2/c16-12-6-7-14-13(8-12)17(15(18)10-19-14)9-11-4-2-1-3-5-11/h1-8H,9-10H2 |
| InChIKey | XVMDQDODKWPXEB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |