C10H8BrNO3 — CID 62024846
2-(6-bromo-3-oxo-1,4-benzoxazin-4-yl)acetaldehyde (PubChem CID 62024846) has the molecular formula C10H8BrNO3 and a molecular weight of 270.08 g/mol. Its IUPAC name is 2-(6-bromo-3-oxo-1,4-benzoxazin-4-yl)acetaldehyde.
| Compound Name | 2-(6-bromo-3-oxo-1,4-benzoxazin-4-yl)acetaldehyde |
|---|---|
| PubChem CID | 62024846 |
| Molecular Formula | C10H8BrNO3 |
| Molecular Weight | 270.08 g/mol |
| Exact Mass | 268.97 |
| IUPAC Name | 2-(6-bromo-3-oxo-1,4-benzoxazin-4-yl)acetaldehyde |
| SMILES | O=CCN1C(=O)COc2ccc(Br)cc21 |
| InChI | InChI=1S/C10H8BrNO3/c11-7-1-2-9-8(5-7)12(3-4-13)10(14)6-15-9/h1-2,4-5H,3,6H2 |
| InChIKey | PKSWTVGLGUFJSD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.08 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|