C12H14BrNO3 — CID 23148519
6-bromo-4-(3-methoxypropyl)-1,4-benzoxazin-3-one (PubChem CID 23148519) has the molecular formula C12H14BrNO3 and a molecular weight of 300.15 g/mol. Its IUPAC name is 6-bromo-4-(3-methoxypropyl)-1,4-benzoxazin-3-one.
| Compound Name | 6-bromo-4-(3-methoxypropyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 23148519 |
| Molecular Formula | C12H14BrNO3 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 6-bromo-4-(3-methoxypropyl)-1,4-benzoxazin-3-one |
| SMILES | COCCCN1C(=O)COc2ccc(Br)cc21 |
| InChI | InChI=1S/C12H14BrNO3/c1-16-6-2-5-14-10-7-9(13)3-4-11(10)17-8-12(14)15/h3-4,7H,2,5-6,8H2,1H3 |
| InChIKey | VDHSREOQFXLTOM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|