C31H31ClNO3P — CID 86613724
[4-(3-methoxypropyl)-3-oxo-1,4-benzoxazin-6-yl]methyl-triphenylphosphanium chloride (PubChem CID 86613724) has the molecular formula C31H31ClNO3P and a molecular weight of 532.02 g/mol. Its IUPAC name is [4-(3-methoxypropyl)-3-oxo-1,4-benzoxazin-6-yl]methyl-triphenylphosphanium chloride.
| Compound Name | [4-(3-methoxypropyl)-3-oxo-1,4-benzoxazin-6-yl]methyl-triphenylphosphanium chloride |
|---|---|
| PubChem CID | 86613724 |
| Molecular Formula | C31H31ClNO3P |
| Molecular Weight | 532.02 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | [4-(3-methoxypropyl)-3-oxo-1,4-benzoxazin-6-yl]methyl-triphenylphosphanium chloride |
| SMILES | COCCCN1C(=O)COc2ccc(C[P+](c3ccccc3)(c3ccccc3)c3ccccc3)cc21.[Cl-] |
| InChI | InChI=1S/C31H31NO3P.ClH/c1-34-21-11-20-32-29-22-25(18-19-30(29)35-23-31(32)33)24-36(26-12-5-2-6-13-26,27-14-7-3-8-15-27)28-16-9-4-10-17-28;/h2-10,12-19,22H,11,20-21,23-24H2,1H3;1H/q+1;/p-1 |
| InChIKey | GDYXUVBYPMDYCQ-UHFFFAOYSA-M |
| XLogP | 1.95 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.02 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|