C17H22N2O5 — CID 42786133
4-(6-acetyl-3-oxo-1,4-benzoxazin-4-yl)-N-(2-methoxyethyl)butanamide (PubChem CID 42786133) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is 4-(6-acetyl-3-oxo-1,4-benzoxazin-4-yl)-N-(2-methoxyethyl)butanamide.
| Compound Name | 4-(6-acetyl-3-oxo-1,4-benzoxazin-4-yl)-N-(2-methoxyethyl)butanamide |
|---|---|
| PubChem CID | 42786133 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 4-(6-acetyl-3-oxo-1,4-benzoxazin-4-yl)-N-(2-methoxyethyl)butanamide |
| SMILES | COCCNC(=O)CCCN1C(=O)COc2ccc(C(C)=O)cc21 |
| InChI | InChI=1S/C17H22N2O5/c1-12(20)13-5-6-15-14(10-13)19(17(22)11-24-15)8-3-4-16(21)18-7-9-23-2/h5-6,10H,3-4,7-9,11H2,1-2H3,(H,18,21) |
| InChIKey | UOFZZGMCFRBMPA-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|