C24H27ClN2O6 — CID 46035319
4-[6-[2-(2-chloro-4-methylphenoxy)acetyl]-3-oxo-1,4-benzoxazin-4-yl]-N-(2-methoxyethyl)butanamide (PubChem CID 46035319) has the molecular formula C24H27ClN2O6 and a molecular weight of 474.94 g/mol. Its IUPAC name is 4-[6-[2-(2-chloro-4-methylphenoxy)acetyl]-3-oxo-1,4-benzoxazin-4-yl]-N-(2-methoxyethyl)butanamide.
| Compound Name | 4-[6-[2-(2-chloro-4-methylphenoxy)acetyl]-3-oxo-1,4-benzoxazin-4-yl]-N-(2-methoxyethyl)butanamide |
|---|---|
| PubChem CID | 46035319 |
| Molecular Formula | C24H27ClN2O6 |
| Molecular Weight | 474.94 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 4-[6-[2-(2-chloro-4-methylphenoxy)acetyl]-3-oxo-1,4-benzoxazin-4-yl]-N-(2-methoxyethyl)butanamide |
| SMILES | COCCNC(=O)CCCN1C(=O)COc2ccc(C(=O)COc3ccc(C)cc3Cl)cc21 |
| InChI | InChI=1S/C24H27ClN2O6/c1-16-5-7-21(18(25)12-16)32-14-20(28)17-6-8-22-19(13-17)27(24(30)15-33-22)10-3-4-23(29)26-9-11-31-2/h5-8,12-13H,3-4,9-11,14-15H2,1-2H3,(H,26,29) |
| InChIKey | BZGPSYAOSGBIMR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.94 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|