C22H23ClN2O6 — CID 42847131
2-[6-[2-(4-chloro-3-methylphenoxy)acetyl]-3-oxo-1,4-benzoxazin-4-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 42847131) has the molecular formula C22H23ClN2O6 and a molecular weight of 446.89 g/mol. Its IUPAC name is 2-[6-[2-(4-chloro-3-methylphenoxy)acetyl]-3-oxo-1,4-benzoxazin-4-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[6-[2-(4-chloro-3-methylphenoxy)acetyl]-3-oxo-1,4-benzoxazin-4-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 42847131 |
| Molecular Formula | C22H23ClN2O6 |
| Molecular Weight | 446.89 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 2-[6-[2-(4-chloro-3-methylphenoxy)acetyl]-3-oxo-1,4-benzoxazin-4-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN1C(=O)COc2ccc(C(=O)COc3ccc(Cl)c(C)c3)cc21 |
| InChI | InChI=1S/C22H23ClN2O6/c1-14-9-16(4-5-17(14)23)30-12-19(26)15-3-6-20-18(10-15)25(22(28)13-31-20)11-21(27)24-7-8-29-2/h3-6,9-10H,7-8,11-13H2,1-2H3,(H,24,27) |
| InChIKey | VXCQOOCQCYTKMK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.89 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|