C25H30N2O6 — CID 42846928
4-[6-[2-(2,5-dimethylphenoxy)acetyl]-3-oxo-1,4-benzoxazin-4-yl]-N-(2-methoxyethyl)butanamide (PubChem CID 42846928) has the molecular formula C25H30N2O6 and a molecular weight of 454.52 g/mol. Its IUPAC name is 4-[6-[2-(2,5-dimethylphenoxy)acetyl]-3-oxo-1,4-benzoxazin-4-yl]-N-(2-methoxyethyl)butanamide.
| Compound Name | 4-[6-[2-(2,5-dimethylphenoxy)acetyl]-3-oxo-1,4-benzoxazin-4-yl]-N-(2-methoxyethyl)butanamide |
|---|---|
| PubChem CID | 42846928 |
| Molecular Formula | C25H30N2O6 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 4-[6-[2-(2,5-dimethylphenoxy)acetyl]-3-oxo-1,4-benzoxazin-4-yl]-N-(2-methoxyethyl)butanamide |
| SMILES | COCCNC(=O)CCCN1C(=O)COc2ccc(C(=O)COc3cc(C)ccc3C)cc21 |
| InChI | InChI=1S/C25H30N2O6/c1-17-6-7-18(2)23(13-17)32-15-21(28)19-8-9-22-20(14-19)27(25(30)16-33-22)11-4-5-24(29)26-10-12-31-3/h6-9,13-14H,4-5,10-12,15-16H2,1-3H3,(H,26,29) |
| InChIKey | DYEXMTADLISOMP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|