C26H32N2O6 — CID 46035435
N-(2-methoxyethyl)-4-[3-oxo-6-[2-(2,4,6-trimethylphenoxy)acetyl]-1,4-benzoxazin-4-yl]butanamide (PubChem CID 46035435) has the molecular formula C26H32N2O6 and a molecular weight of 468.55 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-[3-oxo-6-[2-(2,4,6-trimethylphenoxy)acetyl]-1,4-benzoxazin-4-yl]butanamide.
| Compound Name | N-(2-methoxyethyl)-4-[3-oxo-6-[2-(2,4,6-trimethylphenoxy)acetyl]-1,4-benzoxazin-4-yl]butanamide |
|---|---|
| PubChem CID | 46035435 |
| Molecular Formula | C26H32N2O6 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | N-(2-methoxyethyl)-4-[3-oxo-6-[2-(2,4,6-trimethylphenoxy)acetyl]-1,4-benzoxazin-4-yl]butanamide |
| SMILES | COCCNC(=O)CCCN1C(=O)COc2ccc(C(=O)COc3c(C)cc(C)cc3C)cc21 |
| InChI | InChI=1S/C26H32N2O6/c1-17-12-18(2)26(19(3)13-17)34-15-22(29)20-7-8-23-21(14-20)28(25(31)16-33-23)10-5-6-24(30)27-9-11-32-4/h7-8,12-14H,5-6,9-11,15-16H2,1-4H3,(H,27,30) |
| InChIKey | UQXYMVOLKFOHJZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|