C25H23ClN2O7 — CID 46034362
5-[[6-[2-(3-chlorophenoxy)acetyl]-3-oxo-1,4-benzoxazin-4-yl]methyl]-N-(2-methoxyethyl)furan-2-carboxamide (PubChem CID 46034362) has the molecular formula C25H23ClN2O7 and a molecular weight of 498.92 g/mol. Its IUPAC name is 5-[[6-[2-(3-chlorophenoxy)acetyl]-3-oxo-1,4-benzoxazin-4-yl]methyl]-N-(2-methoxyethyl)furan-2-carboxamide.
| Compound Name | 5-[[6-[2-(3-chlorophenoxy)acetyl]-3-oxo-1,4-benzoxazin-4-yl]methyl]-N-(2-methoxyethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 46034362 |
| Molecular Formula | C25H23ClN2O7 |
| Molecular Weight | 498.92 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 5-[[6-[2-(3-chlorophenoxy)acetyl]-3-oxo-1,4-benzoxazin-4-yl]methyl]-N-(2-methoxyethyl)furan-2-carboxamide |
| SMILES | COCCNC(=O)c1ccc(CN2C(=O)COc3ccc(C(=O)COc4cccc(Cl)c4)cc32)o1 |
| InChI | InChI=1S/C25H23ClN2O7/c1-32-10-9-27-25(31)23-8-6-19(35-23)13-28-20-11-16(5-7-22(20)34-15-24(28)30)21(29)14-33-18-4-2-3-17(26)12-18/h2-8,11-12H,9-10,13-15H2,1H3,(H,27,31) |
| InChIKey | SMPNBCURYXMTMA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 107.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.92 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|