C25H25N3O8 — CID 42846560
N-(2-methoxyethyl)-2-[[6-[2-(3-methoxyphenoxy)acetyl]-3-oxo-1,4-benzoxazin-4-yl]methyl]-1,3-oxazole-4-carboxamide (PubChem CID 42846560) has the molecular formula C25H25N3O8 and a molecular weight of 495.49 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[[6-[2-(3-methoxyphenoxy)acetyl]-3-oxo-1,4-benzoxazin-4-yl]methyl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-(2-methoxyethyl)-2-[[6-[2-(3-methoxyphenoxy)acetyl]-3-oxo-1,4-benzoxazin-4-yl]methyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 42846560 |
| Molecular Formula | C25H25N3O8 |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | N-(2-methoxyethyl)-2-[[6-[2-(3-methoxyphenoxy)acetyl]-3-oxo-1,4-benzoxazin-4-yl]methyl]-1,3-oxazole-4-carboxamide |
| SMILES | COCCNC(=O)c1coc(CN2C(=O)COc3ccc(C(=O)COc4cccc(OC)c4)cc32)n1 |
| InChI | InChI=1S/C25H25N3O8/c1-32-9-8-26-25(31)19-13-36-23(27-19)12-28-20-10-16(6-7-22(20)35-15-24(28)30)21(29)14-34-18-5-3-4-17(11-18)33-2/h3-7,10-11,13H,8-9,12,14-15H2,1-2H3,(H,26,31) |
| InChIKey | AWAYZECXABJALR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 129.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|