C21H27N3O5 — CID 42788102
2-[(6-tert-butyl-3-oxo-1,4-benzoxazin-4-yl)methyl]-N-(3-methoxypropyl)-1,3-oxazole-4-carboxamide (PubChem CID 42788102) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is 2-[(6-tert-butyl-3-oxo-1,4-benzoxazin-4-yl)methyl]-N-(3-methoxypropyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[(6-tert-butyl-3-oxo-1,4-benzoxazin-4-yl)methyl]-N-(3-methoxypropyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 42788102 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 2-[(6-tert-butyl-3-oxo-1,4-benzoxazin-4-yl)methyl]-N-(3-methoxypropyl)-1,3-oxazole-4-carboxamide |
| SMILES | COCCCNC(=O)c1coc(CN2C(=O)COc3ccc(C(C)(C)C)cc32)n1 |
| InChI | InChI=1S/C21H27N3O5/c1-21(2,3)14-6-7-17-16(10-14)24(19(25)13-28-17)11-18-23-15(12-29-18)20(26)22-8-5-9-27-4/h6-7,10,12H,5,8-9,11,13H2,1-4H3,(H,22,26) |
| InChIKey | TUVAPJDTPAPQEJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|