C21H26N4O5 — CID 42788139
2-[(6-methyl-3-oxo-1,4-benzoxazin-4-yl)methyl]-N-(3-morpholin-4-ylpropyl)-1,3-oxazole-4-carboxamide (PubChem CID 42788139) has the molecular formula C21H26N4O5 and a molecular weight of 414.46 g/mol. Its IUPAC name is 2-[(6-methyl-3-oxo-1,4-benzoxazin-4-yl)methyl]-N-(3-morpholin-4-ylpropyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[(6-methyl-3-oxo-1,4-benzoxazin-4-yl)methyl]-N-(3-morpholin-4-ylpropyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 42788139 |
| Molecular Formula | C21H26N4O5 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 2-[(6-methyl-3-oxo-1,4-benzoxazin-4-yl)methyl]-N-(3-morpholin-4-ylpropyl)-1,3-oxazole-4-carboxamide |
| SMILES | Cc1ccc2c(c1)N(Cc1nc(C(=O)NCCCN3CCOCC3)co1)C(=O)CO2 |
| InChI | InChI=1S/C21H26N4O5/c1-15-3-4-18-17(11-15)25(20(26)14-29-18)12-19-23-16(13-30-19)21(27)22-5-2-6-24-7-9-28-10-8-24/h3-4,11,13H,2,5-10,12,14H2,1H3,(H,22,27) |
| InChIKey | XKSQSJGYPYFTAC-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 97.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|