C20H29N3O4 — CID 3252883
4-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)-N-(3-morpholin-4-ylpropyl)butanamide (PubChem CID 3252883) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is 4-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)-N-(3-morpholin-4-ylpropyl)butanamide.
| Compound Name | 4-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)-N-(3-morpholin-4-ylpropyl)butanamide |
|---|---|
| PubChem CID | 3252883 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 4-(6-methyl-3-oxo-1,4-benzoxazin-4-yl)-N-(3-morpholin-4-ylpropyl)butanamide |
| SMILES | Cc1ccc2c(c1)N(CCCC(=O)NCCCN1CCOCC1)C(=O)CO2 |
| InChI | InChI=1S/C20H29N3O4/c1-16-5-6-18-17(14-16)23(20(25)15-27-18)9-2-4-19(24)21-7-3-8-22-10-12-26-13-11-22/h5-6,14H,2-4,7-13,15H2,1H3,(H,21,24) |
| InChIKey | OUOLEQDOCPOHNJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|