C14H18N2O4 — CID 82063421
6-hydroxy-4-(2-morpholin-4-ylethyl)-1,4-benzoxazin-3-one (PubChem CID 82063421) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 6-hydroxy-4-(2-morpholin-4-ylethyl)-1,4-benzoxazin-3-one.
| Compound Name | 6-hydroxy-4-(2-morpholin-4-ylethyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82063421 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 6-hydroxy-4-(2-morpholin-4-ylethyl)-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(O)cc2N1CCN1CCOCC1 |
| InChI | InChI=1S/C14H18N2O4/c17-11-1-2-13-12(9-11)16(14(18)10-20-13)4-3-15-5-7-19-8-6-15/h1-2,9,17H,3-8,10H2 |
| InChIKey | RQDCLMIRGRQIFX-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |