C14H19NO3 — CID 82063394
4-hexyl-6-hydroxy-1,4-benzoxazin-3-one (PubChem CID 82063394) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 4-hexyl-6-hydroxy-1,4-benzoxazin-3-one.
| Compound Name | 4-hexyl-6-hydroxy-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82063394 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 4-hexyl-6-hydroxy-1,4-benzoxazin-3-one |
| SMILES | CCCCCCN1C(=O)COc2ccc(O)cc21 |
| InChI | InChI=1S/C14H19NO3/c1-2-3-4-5-8-15-12-9-11(16)6-7-13(12)18-10-14(15)17/h6-7,9,16H,2-5,8,10H2,1H3 |
| InChIKey | GKTWXYUGDKRVOY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|