C15H20INO2 — CID 79785529
4-heptyl-7-iodo-1,4-benzoxazin-3-one (PubChem CID 79785529) has the molecular formula C15H20INO2 and a molecular weight of 373.23 g/mol. Its IUPAC name is 4-heptyl-7-iodo-1,4-benzoxazin-3-one.
| Compound Name | 4-heptyl-7-iodo-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 79785529 |
| Molecular Formula | C15H20INO2 |
| Molecular Weight | 373.23 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 4-heptyl-7-iodo-1,4-benzoxazin-3-one |
| SMILES | CCCCCCCN1C(=O)COc2cc(I)ccc21 |
| InChI | InChI=1S/C15H20INO2/c1-2-3-4-5-6-9-17-13-8-7-12(16)10-14(13)19-11-15(17)18/h7-8,10H,2-6,9,11H2,1H3 |
| InChIKey | BSMQGOYWXRBYRW-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.23 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|