C15H21NO2 — CID 143253505
4-hexyl-6-methyl-1,4-benzoxazin-3-one (PubChem CID 143253505) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 4-hexyl-6-methyl-1,4-benzoxazin-3-one.
| Compound Name | 4-hexyl-6-methyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 143253505 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 4-hexyl-6-methyl-1,4-benzoxazin-3-one |
| SMILES | CCCCCCN1C(=O)COc2ccc(C)cc21 |
| InChI | InChI=1S/C15H21NO2/c1-3-4-5-6-9-16-13-10-12(2)7-8-14(13)18-11-15(16)17/h7-8,10H,3-6,9,11H2,1-2H3 |
| InChIKey | DKOZHGDVFADNCS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|