C11H14N2O2 — CID 82142296
4-(2-aminoethyl)-6-methyl-1,4-benzoxazin-3-one (PubChem CID 82142296) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 4-(2-aminoethyl)-6-methyl-1,4-benzoxazin-3-one.
| Compound Name | 4-(2-aminoethyl)-6-methyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82142296 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 4-(2-aminoethyl)-6-methyl-1,4-benzoxazin-3-one |
| SMILES | Cc1ccc2c(c1)N(CCN)C(=O)CO2 |
| InChI | InChI=1S/C11H14N2O2/c1-8-2-3-10-9(6-8)13(5-4-12)11(14)7-15-10/h2-3,6H,4-5,7,12H2,1H3 |
| InChIKey | DMONSHPWIVEWRI-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |