C12H17N3O2 — CID 115195443
4,6-bis(2-aminoethyl)-1,4-benzoxazin-3-one (PubChem CID 115195443) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 4,6-bis(2-aminoethyl)-1,4-benzoxazin-3-one.
| Compound Name | 4,6-bis(2-aminoethyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 115195443 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 4,6-bis(2-aminoethyl)-1,4-benzoxazin-3-one |
| SMILES | NCCc1ccc2c(c1)N(CCN)C(=O)CO2 |
| InChI | InChI=1S/C12H17N3O2/c13-4-3-9-1-2-11-10(7-9)15(6-5-14)12(16)8-17-11/h1-2,7H,3-6,8,13-14H2 |
| InChIKey | KQPRLWFEDOVXMI-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |