C13H18N2O4 — CID 115122329
6-(2-aminoethyl)-4-(2,3-dihydroxypropyl)-1,4-benzoxazin-3-one (PubChem CID 115122329) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is 6-(2-aminoethyl)-4-(2,3-dihydroxypropyl)-1,4-benzoxazin-3-one.
| Compound Name | 6-(2-aminoethyl)-4-(2,3-dihydroxypropyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 115122329 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 6-(2-aminoethyl)-4-(2,3-dihydroxypropyl)-1,4-benzoxazin-3-one |
| SMILES | NCCc1ccc2c(c1)N(CC(O)CO)C(=O)CO2 |
| InChI | InChI=1S/C13H18N2O4/c14-4-3-9-1-2-12-11(5-9)15(6-10(17)7-16)13(18)8-19-12/h1-2,5,10,16-17H,3-4,6-8,14H2 |
| InChIKey | LCQJCNQYJUDICT-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |