C15H22N2O4 — CID 82028450
6-(1-aminobutyl)-4-(2,3-dihydroxypropyl)-1,4-benzoxazin-3-one (PubChem CID 82028450) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 6-(1-aminobutyl)-4-(2,3-dihydroxypropyl)-1,4-benzoxazin-3-one.
| Compound Name | 6-(1-aminobutyl)-4-(2,3-dihydroxypropyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82028450 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 6-(1-aminobutyl)-4-(2,3-dihydroxypropyl)-1,4-benzoxazin-3-one |
| SMILES | CCCC(N)c1ccc2c(c1)N(CC(O)CO)C(=O)CO2 |
| InChI | InChI=1S/C15H22N2O4/c1-2-3-12(16)10-4-5-14-13(6-10)17(7-11(19)8-18)15(20)9-21-14/h4-6,11-12,18-19H,2-3,7-9,16H2,1H3 |
| InChIKey | WDBOKLHSTMWSSA-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |