C13H15NO5 — CID 117416741
ethyl 2-hydroxy-2-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)acetate (PubChem CID 117416741) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is ethyl 2-hydroxy-2-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)acetate.
| Compound Name | ethyl 2-hydroxy-2-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)acetate |
|---|---|
| PubChem CID | 117416741 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | ethyl 2-hydroxy-2-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)acetate |
| SMILES | CCOC(=O)C(O)c1ccc2c(c1)N(C)C(=O)CO2 |
| InChI | InChI=1S/C13H15NO5/c1-3-18-13(17)12(16)8-4-5-10-9(6-8)14(2)11(15)7-19-10/h4-6,12,16H,3,7H2,1-2H3 |
| InChIKey | DEVWLYVSSXUOFR-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |