C14H17NO4 — CID 116964415
methyl 2-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)butanoate (PubChem CID 116964415) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is methyl 2-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)butanoate.
| Compound Name | methyl 2-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)butanoate |
|---|---|
| PubChem CID | 116964415 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | methyl 2-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)butanoate |
| SMILES | CCC(C(=O)OC)c1ccc2c(c1)N(C)C(=O)CO2 |
| InChI | InChI=1S/C14H17NO4/c1-4-10(14(17)18-3)9-5-6-12-11(7-9)15(2)13(16)8-19-12/h5-7,10H,4,8H2,1-3H3 |
| InChIKey | AWPUIKWZXMVFRM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |