methyl 2-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)butanoate

C14H17NO4 — CID 116964415

IUPACmethyl 2-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)butanoate
SMILESCCC(C(=O)OC)c1ccc2c(c1)N(C)C(=O)CO2
InChIInChI=1S/C14H17NO4/c1-4-10(14(17)18-3)9-5-6-12-11(7-9)15(2)13(16)8-19-12/h5-7,10H,4,8H2,1-3H3
InChIKeyAWPUIKWZXMVFRM-UHFFFAOYSA-N
MW263.29 g/mol
LogP1.71
Rot. Bonds3

About methyl 2-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)butanoate

methyl 2-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)butanoate (PubChem CID 116964415) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is methyl 2-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)butanoate.

Molecular Properties

Compound Namemethyl 2-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)butanoate
PubChem CID116964415
Molecular FormulaC14H17NO4
Molecular Weight263.29 g/mol
Exact Mass263.12
IUPAC Namemethyl 2-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)butanoate
SMILESCCC(C(=O)OC)c1ccc2c(c1)N(C)C(=O)CO2
InChIInChI=1S/C14H17NO4/c1-4-10(14(17)18-3)9-5-6-12-11(7-9)15(2)13(16)8-19-12/h5-7,10H,4,8H2,1-3H3
InChIKeyAWPUIKWZXMVFRM-UHFFFAOYSA-N
XLogP1.71
TPSA55.84 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.29
LogP ≤ 51.71
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)butanoate?
The IUPAC name of methyl 2-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)butanoate (CID 116964415) is methyl 2-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)butanoate.
What is the SMILES notation for methyl 2-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)butanoate?
The canonical SMILES for methyl 2-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)butanoate is CCC(C(=O)OC)c1ccc2c(c1)N(C)C(=O)CO2.
What is the InChIKey of methyl 2-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)butanoate?
The InChIKey is AWPUIKWZXMVFRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO4/c1-4-10(14(17)18-3)9-5-6-12-11(7-9)15(2)13(16)8-19-12/h5-7,10H,4,8H2,1-3H3.
What are the key properties of methyl 2-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)butanoate?
methyl 2-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)butanoate has a molecular weight of 263.29 g/mol, XLogP of 1.71, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)butanoate is sourced from PubChem (CID 116964415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).