C13H19N3O2 — CID 116947950
6-[1,2-bis(methylamino)ethyl]-4-methyl-1,4-benzoxazin-3-one (PubChem CID 116947950) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is 6-[1,2-bis(methylamino)ethyl]-4-methyl-1,4-benzoxazin-3-one.
| Compound Name | 6-[1,2-bis(methylamino)ethyl]-4-methyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 116947950 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 6-[1,2-bis(methylamino)ethyl]-4-methyl-1,4-benzoxazin-3-one |
| SMILES | CNCC(NC)c1ccc2c(c1)N(C)C(=O)CO2 |
| InChI | InChI=1S/C13H19N3O2/c1-14-7-10(15-2)9-4-5-12-11(6-9)16(3)13(17)8-18-12/h4-6,10,14-15H,7-8H2,1-3H3 |
| InChIKey | SPYUCUJTNJONER-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |