C14H21N3O2 — CID 116934050
6-(1,4-diamino-2-methylbutyl)-4-methyl-1,4-benzoxazin-3-one (PubChem CID 116934050) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 6-(1,4-diamino-2-methylbutyl)-4-methyl-1,4-benzoxazin-3-one.
| Compound Name | 6-(1,4-diamino-2-methylbutyl)-4-methyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 116934050 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 6-(1,4-diamino-2-methylbutyl)-4-methyl-1,4-benzoxazin-3-one |
| SMILES | CC(CCN)C(N)c1ccc2c(c1)N(C)C(=O)CO2 |
| InChI | InChI=1S/C14H21N3O2/c1-9(5-6-15)14(16)10-3-4-12-11(7-10)17(2)13(18)8-19-12/h3-4,7,9,14H,5-6,8,15-16H2,1-2H3 |
| InChIKey | QYXOIFOFPGFNCA-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |