C13H15NO4 — CID 116964414
methyl 2-(3-oxo-4H-1,4-benzoxazin-6-yl)butanoate (PubChem CID 116964414) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is methyl 2-(3-oxo-4H-1,4-benzoxazin-6-yl)butanoate.
| Compound Name | methyl 2-(3-oxo-4H-1,4-benzoxazin-6-yl)butanoate |
|---|---|
| PubChem CID | 116964414 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | methyl 2-(3-oxo-4H-1,4-benzoxazin-6-yl)butanoate |
| SMILES | CCC(C(=O)OC)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C13H15NO4/c1-3-9(13(16)17-2)8-4-5-11-10(6-8)14-12(15)7-18-11/h4-6,9H,3,7H2,1-2H3,(H,14,15) |
| InChIKey | DVZNMQMXYMEXGE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |